| Catalog Number |
ACM16725534 |
| CAS |
16725-53-4 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/16725-53-4.gif) |
| IUPAC Name |
[(Z)-tetradec-9-enyl] acetate |
| Synonyms |
(Z)-9-Tetradecenyl acetate;16725-53-4;[(Z)-tetradec-9-enyl] acetate;(Z)-9-Tetradecen-1-ol acetate;9-Tetradecen-1-ol, acetate, (Z)-;Z-9-Tetradecenyl acetate;UNII-TN9973W29F;9Z-Tetradecenyl acetate;(z)-9-tetradecen-1-yl acetate;CIS-9-TETRADECENYL ACETATE;TN9973W29F;9-Tetradecen-1-ol, acetate, (9Z)-;9-Tetradecen-1-ol, 1-acetate, (9Z)-;EINECS 240-780-1;AI3-33474;(9Z)-tetradecen-1-yl acetate;(9Z)-9-Tetradecenyl acetate;SCHEMBL434446;Z-9-Tetradecen-1-ol acetate;Z-9-Tetradecen-1-yl acetate;DTXSID50894976;Acetic acid (9Z)-9-tetradecenyl;(Z)-tetradec-9-en-1-yl acetate;[(Z)-tetradec-9-enyl] ethanoate;LMFA07010316;ZINC12405099;acetic acid [(Z)-tetradec-9-enyl] ester;A810836;Q27290039;(Z)-9-Tetradecen-1-yl acetate 100 microg/mL in Acetonitrile |
| Molecular Weight |
254.41g/mol |
| Molecular Formula |
C16H30O2 |
| Canonical SMILES |
CCCCC=CCCCCCCCCOC(=O)C |
| InChI |
InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h6-7H,3-5,8-15H2,1-2H3/b7-6- |
| InChI Key |
XXPBOEBNDHAAQH-SREVYHEPSA-N |
| Purity |
99%+ |
| Appearance |
Colorless liquid |
| Application |
(Z)-9-Tetradecenyl Acetate is one of the sex pheromone components of Ostrinia genus in Japan. |
| Storage |
Freezer |
| Complexity |
209 |
| Covalently-Bonded Unit Count |
1 |
| EC Number |
240-780-1 |
| Exact Mass |
254.224580195g/mol |
| Heavy Atom Count |
18 |
| Hydrogen Bond Acceptor Count |
2 |
| Monoisotopic Mass |
254.224580195g/mol |
| References |
Ishikawa, Y., et al.: Entomol. Exp. Appl., 91, 237 (1999); |
| Rotatable Bond Count |
13 |
| Topological Polar Surface Area |
26.3Ų |
| UNII |
TN9973W29F |
| X Log P3 |
5.9 |