Online Inquiry
(Z,E)-7,11-Hexadecadien-1-yl acetate
| Catalog Number | ACM53042798-1 |
| CAS | 53042-79-8 |
| Structure |  |
| IUPAC Name | [(7Z,11E)-hexadeca-7,11-dienyl] acetate |
| Synonyms | 53042-79-8;(Z,E)-7,11-Hexadecadien-1-yl acetate;(Z,E)-gossyplure;UNII-2FG77051CT;7Z,11E-Hexadecadienyl acetate;[(7Z,11E)-hexadeca-7,11-dienyl] acetate;2FG77051CT;GOSSYPLURE;Gossyplure HF;Phercon PBW;Nomate PBW MEC;(E,Z)-Gossyplure;Gossyplure (Z,E);Caswell No. 471AAA;(7Z,11E)-Gossyplure;7,11-Hexadecadien-1-ol, 1-acetate;(7Z,11E)-Hexadecadien-1-yl acetate;Hercon disrupt pink bollworm;cis-7-trans-11-Hexadecadienyl acetate;EPA Pesticide Chemical Code 114101;BRN 1911946;(E,Z)-7,11-Hexadecadien-1-ol acetate;AI3-36288;7,11-Hexadecadien-1-ol, acetate, (E,Z)-;50933-33-0;7,11-Hexadecadien-1-ol, acetate, (7Z,11E)-;SCHEMBL2859205;DTXSID3032410;z,e-7,11-hexadecadienyl acetate;LMFA07010373;ZINC31982687;AKOS015959025;(7Z)-7,11-Hexadecadiene-1-ol acetate;Hexadeca-7,11-dien-1-yl acetate (Z,E)-;J3.498.568E;(7Z,11E)-HEXADECA-7,11-DIEN-1-YL ACETATE;Q27254677;UNII-131Z40260G component BXJHOKLLMOYSRQ-WFKFFMJQSA-N |
| Molecular Weight | 280.4g/mol |
| Molecular Formula | C18H32O2 |
| Canonical SMILES | CCCCC=CCCC=CCCCCCCOC(=O)C |
| InChI | InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7,10-11H,3-5,8-9,12-17H2,1-2H3/b7-6+,11-10- |
| InChI Key | BXJHOKLLMOYSRQ-WFKFFMJQSA-N |
| Boiling Point | 130-132 °C |
| Density | 0.885 at 20 °C |
| Solubility | In water, 0.2 mg/L at 25 °C;Soluble in most organic solvents. |
| Application | Insect hormones, Intermediates |
| Color Form | Colorless or light yellow liquid;Yellow liquid |
| Complexity | 267 |
| Covalently-Bonded Unit Count | 1 |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
| EC Number | 256-857-8 |
| Exact Mass | 280.240230259g/mol |
| Heavy Atom Count | 20 |
| Hydrogen Bond Acceptor Count | 2 |
| Log P | log Kow = 7.31 (est) |
| Monoisotopic Mass | 280.240230259g/mol |
| Odor | Mild, sweet odor |
| Rotatable Bond Count | 14 |
| Topological Polar Surface Area | 26.3Ų |
| UNII | 2FG77051CT |
| Vapor Pressure | 8.251X10-5 mm Hg at 25 °C (11 mPa) |
| X Log P3 | 6 |
Please kindly note that our products and services are for research use only.