| Catalog Number | ACM52207995-3 |
| CAS | 52207-99-5 |
| Structure | ![]() |
| IUPAC Name | [(7Z,11Z)-hexadeca-7,11-dienyl] acetate |
| Synonyms | (Z,Z)-Gossyplure;Gossyplure (Z,Z)-;52207-99-5;GOSSYPLURE;7,11-Hexadecadien-1-ol, acetate, (Z,Z)-;UNII-W52P5A61DR;(Z,Z)-7,11-Hexadecadienyl Acetate;W52P5A61DR;7Z,11Z-Hexadecadienyl acetate;(Z,Z)-Hexadeca-7,11-dienyl acetate;Nomate PBW;(7Z,11Z)-Hexadecadien-1-yl acetate;Gossyplure H.F.;7,11-Hexadecadien-1-ol, acetate;50933-33-0;EINECS 256-857-8;EINECS 257-737-8;EPA Pesticide Chemical Code 114102;EPA Pesticide Chemical Code 114103;BRN 1911945;AI3-36282;7,11-Hexadecadien-1-ol, 1-acetate;HSDB 7613;(Z,E)-7,11-Hexadecadien-1-ol, acetate;(Z,Z)-7,11-Hexadecadien-1-ol, acetate;[(7Z,11Z)-hexadeca-7,11-dienyl] acetate;(7Z,11Z)-hexadeca-7,11-dien-1-yl acetate;7,11-Hexadecadien-1-ol, acetate, (7Z,11Z)-;SCHEMBL832055;DTXSID9035751;LMFA07010375;ZINC31982684;Z,Z-7,11-Hexadecadien-1-ol acetate;Z,Z-7,11-Hexadecadien-1-yl acetate;(7Z,11Z)-7,11-Hexadecadienyl acetate;cis-7,cis-11-Hexadecadien-1-yl acetate;Q27292319;UNII-131Z40260G component BXJHOKLLMOYSRQ-QOXWLJPHSA-N |
| Molecular Weight | 280.4g/mol |
| Molecular Formula | C18H32O2 |
| Canonical SMILES | CCCCC=CCCC=CCCCCCCOC(=O)C |
| InChI | InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7,10-11H,3-5,8-9,12-17H2,1-2H3/b7-6-,11-10- |
| InChI Key | BXJHOKLLMOYSRQ-QOXWLJPHSA-N |
| Boiling Point | 130-132 °C |
| Density | 0.885 at 20 °C |
| Solubility | In water, 0.2 mg/L at 25 °C;Soluble in most organic solvents. |
| Color Form | Colorless or light yellow liquid;Yellow liquid |
| Complexity | 267 |
| Covalently-Bonded Unit Count | 1 |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
| EC Number | 256-857-8;257-737-8 |
| Exact Mass | 280.240230259g/mol |
| Heavy Atom Count | 20 |
| Hydrogen Bond Acceptor Count | 2 |
| Log P | log Kow = 7.31 (est) |
| Monoisotopic Mass | 280.240230259g/mol |
| Odor | Mild, sweet odor |
| Rotatable Bond Count | 14 |
| Topological Polar Surface Area | 26.3Ų |
| UNII | W52P5A61DR |
| Vapor Pressure | 8.251X10-5 mm Hg at 25 °C (11 mPa) |
| X Log P3 | 6 |