Online Inquiry
(5-Methoxybenzofuran-2-yl)boronic acid
| Catalog Number | ACM551001797 |
| CAS | 551001-79-7 |
| Structure |  |
| IUPAC Name | (5-methoxy-1-benzofuran-2-yl)boronic acid |
| Synonyms | (5-methoxybenzofuran-2-yl)boronic acid;551001-79-7;5-METHOXYBENZOFURAN-2-YLBORONIC ACID;(5-METHOXY-1-BENZOFURAN-2-YL)BORONIC ACID;5-METHOXYBENZOFURAN-2-BORONIC ACID;Boronic acid, (5-methoxy-2-benzofuranyl)-;SCHEMBL2963271;5-Methoxybenzofuran boronic acid;DTXSID10623527;5-Methoxy-2-benzofuranboronic acid;5-Methoxy-benzofuran-2-boronic acid;MFCD06801701;5-methoxy-2-benzofuranyl-boronic acid;AKOS004119269;ZINC169747524;AB30112;CS-W021117;DS-9408;AK158880;AM806757 |
| Molecular Weight | 191.98g/mol |
| Molecular Formula | C9H9BO4 |
| Canonical SMILES | B(C1=CC2=C(O1)C=CC(=C2)OC)(O)O |
| InChI | InChI=1S/C9H9BO4/c1-13-7-2-3-8-6(4-7)5-9(14-8)10(11)12/h2-5,11-12H,1H3 |
| InChI Key | XLIQZZGLIJLKTF-UHFFFAOYSA-N |
| Complexity | 199 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 192.0593889g/mol |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 4 |
| Monoisotopic Mass | 192.0593889g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 62.8Ų |
Please kindly note that our products and services are for research use only.