We use cookies to understand how you use our site and to improve the overall user experience. This includes personalizing content and advertising. Read our Privacy Policy
Accept Cookies
Online Inquiry
Bis(triphenylphosphine)palladium(II) chloride
| Catalog Number | ACM13965032-3 |
| CAS | 13965-03-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/13965-03-2.gif) |
| IUPAC Name | palladium(2+);triphenylphosphane;dichloride |
| Synonyms | (Ph3P)2Pd(II)Cl2;Bis(triphenylphosphine)palladium Chloride;PdCl2(PPh3)2;trans-dichlorobis(triphenylphosphine)palladium (II);dichlorobis(triphenylphosphine)palladium(II) |
| Molecular Weight | 701.91 |
| Molecular Formula | C36H30Cl2P2Pd |
| Canonical SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Pd]Cl |
| InChI | InChI=1S/2C18H15P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;2*1H;/q;+2/p-2 |
| InChI Key | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| Melting Point | 260ºC |
| Flash Point | 181.7ºC |
| Purity | 98% |
| Appearance | Yellow crystals |
| Complexity | 204 |
| Covalently-Bonded Unit Count | 3 |
| EC Number | 237-744-2;233-495-9 |
| Exact Mass | 700.02346 |
| Heavy Atom Count | 41 |
| Hydrogen Bond Acceptor Count | 0 |
| Log P | 8.26860 |
| MDL Number | MFCD00009593 |
| Monoisotopic Mass | 700.02346 |
| PSA | 27.18 |
| Rotatable Bond Count | 6 |
| Stability | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Topological Polar Surface Area | 0 Ų |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.