Online Inquiry
Bis(triphenylphosphine)palladium(II) chloride
| Catalog Number | ACM13965032-3 |
| CAS | 13965-03-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/13965-03-2.gif) |
| IUPAC Name | palladium(2+);triphenylphosphane;dichloride |
| Synonyms | (Ph3P)2Pd(II)Cl2;Bis(triphenylphosphine)palladium Chloride;PdCl2(PPh3)2;trans-dichlorobis(triphenylphosphine)palladium (II);dichlorobis(triphenylphosphine)palladium(II) |
| Molecular Weight | 701.91 |
| Molecular Formula | C36H30Cl2P2Pd |
| Canonical SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Pd]Cl |
| InChI | InChI=1S/2C18H15P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;2*1H;/q;+2/p-2 |
| InChI Key | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| Melting Point | 260ºC |
| Flash Point | 181.7ºC |
| Purity | 98% |
| Appearance | Yellow crystals |
| Complexity | 204 |
| Covalently-Bonded Unit Count | 3 |
| EC Number | 237-744-2;233-495-9 |
| Exact Mass | 700.02346 |
| Heavy Atom Count | 41 |
| Hydrogen Bond Acceptor Count | 0 |
| Log P | 8.26860 |
| MDL Number | MFCD00009593 |
| Monoisotopic Mass | 700.02346 |
| PSA | 27.18 |
| Rotatable Bond Count | 6 |
| Stability | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Topological Polar Surface Area | 0 Ų |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.