| Catalog Number |
ACM87514 |
| CAS |
87-51-4 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/87-51-4.gif) |
| IUPAC Name |
2-(1H-Indol-3-yl)acetic acid |
| Synonyms |
Rhizopon A |
| Molecular Weight |
175.18 |
| Molecular Formula |
C10H9NO2 |
| Canonical SMILES |
C1=CC=C2C(=C1)C(=CN2)CC(=O)O |
| InChI |
InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
| InChI Key |
SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| Boiling Point |
306.47 °C |
| Melting Point |
165-169 °C(lit.) |
| Flash Point |
171 °C |
| Purity |
98% |
| Density |
1.1999 g/cm³ |
| Solubility |
Aqueous KOH |
| Appearance |
Solid |
| Application |
IAA belongs to the auxin class of plant growth regulators that promote root organogenesis and growth, induce callus formation, form adventitious roots, aids in regulation of gravitropism and phototropism, and can induce embryogenesis. IAA can be synthesized in plants from the amino acid tryptophan. |
| Storage |
-20 °C |
| Complexity |
205 |
| EC Number |
201-748-2 |
| Exact Mass |
175.063328530 |
| Form |
Powder |
| Log P |
1.79500 |
| MDL Number |
MFCD00005636 |
| Monoisotopic Mass |
175.063328530 |
| Notes |
Plant Tissue Culture Tested |
| Pack Size |
5g, 25g, 100g |
| PSA |
53.9 |
| Refractive Index |
1.5460 |
| Stability |
Stable. Incompatible with strong oxidizing agents. Light sensitive. |
| Storage Temperature |
-20 °C |
| Topological Polar Surface Area |
53.1 Ų |
| WGK Germany |
3 |